A2503612
2-Chlorobenzyl Bromide , ≥98.0%(GC) , 611-17-6
Synonym(s):
α-Bromo-2-chlorotoluene
CAS NO.:611-17-6
Empirical Formula: C7H6BrCl
Molecular Weight: 205.48
MDL number: MFCD00000566
EINECS: 210-257-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB80.80 | In Stock |
|
| 25G | RMB272.80 | In Stock |
|
| 100G | RMB804.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 83-84 °C |
| Boiling point: | 103-104 °C/10 mmHg (lit.) |
| Density | 1.583 g/mL at 25 °C (lit.) |
| refractive index | 1.591-1.593 |
| Flash point: | 108 °C |
| storage temp. | 2-8°C, sealed storage, away from moisture |
| form | Liquid |
| Specific Gravity | 1.583 |
| color | Clear yellow |
| Sensitive | Lachrymatory |
| BRN | 386264 |
| InChI | InChI=1S/C7H6BrCl/c8-5-6-3-1-2-4-7(6)9/h1-4H,5H2 |
| InChIKey | PURSZYWBIQIANP-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=CC=C1Cl |
| CAS DataBase Reference | 611-17-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-(bromomethyl)-2-chloro-(611-17-6) |
Description and Uses
2-Chlorobenzyl bromide participates in Hass-Bender oxidation as well as the Henry reaction.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P261-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34-36/37 |
| Safety Statements | 45-36/37/39-26-28-27 |
| RIDADR | 1760 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
| Hazardous Substances Data | 611-17-6(Hazardous Substances Data) |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







