A2503912
3-Chloropropyl acetate , 98% , 628-09-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB33.60 | In Stock |
|
| 25G | RMB74.40 | In Stock |
|
| 100G | RMB240.00 | In Stock |
|
| 500G | RMB1115.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 80-81 °C/30 mmHg (lit.) |
| Density | 1.111 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 154 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, DMSO (Slightly), Hexanes (Sparingly), Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| Water Solubility | Soluble in water (partly). |
| InChI | InChI=1S/C5H9ClO2/c1-5(7)8-4-2-3-6/h2-4H2,1H3 |
| InChIKey | KPOHQIPNNIMWRL-UHFFFAOYSA-N |
| SMILES | C(OC(=O)C)CCCl |
| CAS DataBase Reference | 628-09-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Propanol, 3-chloro-, acetate(628-09-1) |
Description and Uses
3-Chloropropyl acetate is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agro chemicals, dyestuff.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 2 |
| RTECS | UA8944000 |
| HS Code | 29153900 |
