A2504712
2-Chloropyridine-N-Oxide , 97% , 2402-95-1
CAS NO.：2402-95-1
Empirical Formula: C5H4ClNO
Molecular Weight: 129.54
MDL number: MFCD00129036
EINECS: 219-284-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB48.80 | In Stock |
|
| 5G | RMB125.60 | In Stock |
|
| 25G | RMB424.80 | In Stock |
|
| 100G | RMB1533.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67-70°C |
| Boiling point: | 168-170C |
| Density | 1,209g/cm |
| refractive index | 1,531-1,533 |
| pka | -0.76±0.10(Predicted) |
| Water Solubility | Insoluble in water. |
| Sensitive | Moisture Sensitive |
| BRN | 108585 |
| InChI | InChI=1S/C5H4ClNO/c6-5-3-1-2-4-7(5)8/h1-4H |
| InChIKey | WYSRTEVFLQJJDN-UHFFFAOYSA-N |
| SMILES | C1(Cl)[N+]([O-])=CC=CC=1 |
| CAS DataBase Reference | 2402-95-1(CAS DataBase Reference) |
Description and Uses
2-Chloropyridine oxide is a cytotoxic and clastogenic compound.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H331-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 23/24/25-36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-45-36-36/37 |
| RIDADR | 2811 |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29333990 |
