A2505412
(-)-Catechin , ≥97%(HPLC) , 18829-70-4
Synonym(s):
(−)-trans-3,3′,4′,5,7-Pentahydroxyflavane;(2S,3R)-2-(3,4-Dihydroxyphenyl)-3,4-dihydro-1(2H)-benzopyran-3,5,7-triol
CAS NO.:18829-70-4
Empirical Formula: C15H14O6
Molecular Weight: 290.27
MDL number: MFCD00135997
EINECS: 242-611-7
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB1152.00 | In Stock |
|
| 25MG | RMB4399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93-96°; 175-177° when anhydr |
| alpha | D -16.8° |
| Boiling point: | 630.4±55.0 °C(Predicted) |
| Density | 1.593±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMF: 25 mg/ml; DMSO: 15 mg/ml; Ethanol: 5 mg/ml; PBS (pH 7.2): 1 mg/ml |
| form | A crystalline solid |
| pka | 9.54±0.10(Predicted) |
| color | White to off-white |
| biological source | green tea |
| InChI | InChI=1S/C15H14O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,13,15-20H,6H2/t13-,15+/m1/s1 |
| InChIKey | PFTAWBLQPZVEMU-HIFRSBDPSA-N |
| SMILES | [C@@H]1(C2=CC=C(O)C(O)=C2)OC2=CC(O)=CC(O)=C2C[C@H]1O |
| LogP | 0.490 (est) |
| CAS DataBase Reference | 18829-70-4(CAS DataBase Reference) |
Description and Uses
In dyeing and tanning.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 10 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




