A2507212
8-Chlorotheophylline , ≥98.0% , 85-18-7
CAS NO.：85-18-7
Empirical Formula: C7H7ClN4O2
Molecular Weight: 214.61
MDL number: MFCD00005581
EINECS: 201-590-4
| Pack Size | Price | Stock | Quantity |
| 25g | RMB91.20 | In Stock |
|
| 50G | RMB159.20 | In Stock |
|
| 100G | RMB287.20 | In Stock |
|
| 250G | RMB671.20 | In Stock |
|
| 1KG | RMB2151.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 290 °C (dec.)(lit.) |
| Boiling point: | 455.0±55.0 °C(Predicted) |
| Density | 1.8869 (rough estimate) |
| refractive index | 1.5560 (estimate) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Soluble in sodium hydroxide. |
| pka | pKa 5.28 (Uncertain) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | SLIGHTLY SOLUBLE |
| BRN | 203068 |
| InChI | InChI=1S/C7H7ClN4O2/c1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14/h1-2H3,(H,9,10) |
| InChIKey | RYIGNEOBDRVTHA-UHFFFAOYSA-N |
| SMILES | N1C2=C(N(C)C(=O)N(C)C2=O)NC=1Cl |
| CAS DataBase Reference | 85-18-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 1H-purine-2,6-dione, 8-chloro-3,7-dihydro-1,3-dimethyl-(85-18-7) |
Description and Uses
8-Chlorotheophylline is a stimulant drug. It can be used as a binding agent to form stable salts of pharmaceutical drugs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312a-P330-P501a-P264-P270-P301+P312+P330-P501 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-22 |
| Safety Statements | 36-37/39-26 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | XH5063000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29395900 |
