A2508612
4′-Chloro-2,2′:6′,2′′-terpyridine , 98% , 128143-89-5
CAS NO.:128143-89-5
Empirical Formula: C15H10ClN3
Molecular Weight: 267.71
MDL number: MFCD00191930
EINECS: 626-940-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB101.60 | In Stock |
|
| 200mg | RMB127.20 | In Stock |
|
| 1G | RMB237.60 | In Stock |
|
| 5G | RMB1130.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148-150 °C(lit.) |
| Boiling point: | 416.73°C (rough estimate) |
| Density | 1.2245 (rough estimate) |
| refractive index | 1.6010 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 4.22±0.22(Predicted) |
| form | Crystalline Powder |
| color | Brown |
| Water Solubility | Slightly soluble in water. |
| λmax | 278nm(CH3CN)(lit.) |
| BRN | 3613386 |
| InChI | InChI=1S/C15H10ClN3/c16-11-9-14(12-5-1-3-7-17-12)19-15(10-11)13-6-2-4-8-18-13/h1-10H |
| InChIKey | AHEMFMCEBIJRMU-UHFFFAOYSA-N |
| SMILES | C1(C2=NC(C3=NC=CC=C3)=CC(Cl)=C2)=NC=CC=C1 |
Description and Uses
4'-Chloro-2,2':6',2''-terpyridine is widely utilized in the field of supramolecular chemistry, which is used to manufacture double helicates, dendrimers, micelles and metallo-supramolecular polymers. It is used to synthesize the mono- and bis-terpyridines. It is actively involved in Williamson type ether reactions alpha,μ-bishydroxy-functionalized poly(propylene oxide).
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |





![4-(4'-Methyl-[2,2'-bipyridin]-4-yl)butanoicacid](https://img.chemicalbook.com/CAS/GIF/114527-28-5.gif)


![4-([2,2':6',2''-Terpyridin]-4'-yl)phenol](https://img.chemicalbook.com/CAS/20180808/GIF/89972-79-2.gif)