PRODUCT Properties
| Melting point: | 262 °C |
| Density | 1.519±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Dimethylformamide |
| form | powder to crystal |
| pka | 8.83±0.20(Predicted) |
| color | Light yellow to Brown |
| InChI | InChI=1S/C8H4ClNO2/c9-4-1-2-5-6(3-4)10-8(12)7(5)11/h1-3H,(H,10,11,12) |
| InChIKey | RVXLBLSGEPQBIO-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC(Cl)=C2)C(=O)C1=O |
| CAS DataBase Reference | 6341-92-0(CAS DataBase Reference) |
Description and Uses
6-Chloroisatin can be used as potential apoptosis inducer in non-small lung cancer AS49 cells.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P501 |
| HS Code | 2933790090 |
