A2513112
Caronic Anhydride , ≥98.0%(GC) , 67911-21-1
| Pack Size | Price | Stock | Quantity |
| 25G | RMB190.40 | In Stock |
|
| 100G | RMB574.40 | In Stock |
|
| 5g | RMB1752.00 | In Stock |
|
| 500g | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 53-57℃ |
| Boiling point: | 246°C |
| Density | 1.274 |
| Flash point: | 113°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | Solid |
| color | White |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C7H8O3/c1-7(2)3-4(7)6(9)10-5(3)8/h3-4H,1-2H3 |
| InChIKey | QKAHKEDLPBJLFD-UHFFFAOYSA-N |
| SMILES | C12C(C1(C)C)C(=O)OC2=O |
| CAS DataBase Reference | 67911-21-1(CAS DataBase Reference) |
Description and Uses
Caronic anhydride, also known as 6,6-Dimethyl-3-oxabicyclo[3.1.0]hexane-2,4-dione, is a pharmaceutical intermediate mainly used as a synthesis of Boceprevir, an oral protease inhibitor of hepatitis C. It is widely used in agricultural chemicals and other organic synthesis field.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HazardClass | IRRITANT |
| HS Code | 2914199090 |
