A2515512
4-Cyanophenyl isothiocyanate , 98% , 2719-32-6
CAS NO.：2719-32-6
Empirical Formula: C8H4N2S
Molecular Weight: 160.2
MDL number: MFCD00041085
EINECS: 220-323-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB93.60 | In Stock |
|
| 5G | RMB376.80 | In Stock |
|
| 25G | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 119-123 °C(lit.) |
| Boiling point: | 314.7±25.0 °C(Predicted) |
| Density | 1.2628 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Keep Cold |
| form | powder to crystal |
| color | White to Orange to Green |
| Sensitive | Lachrymatory |
| BRN | 2802621 |
| InChI | InChI=1S/C8H4N2S/c9-5-7-1-3-8(4-2-7)10-6-11/h1-4H |
| InChIKey | DZFKAXLNKZXNHD-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(N=C=S)C=C1 |
| CAS DataBase Reference | 2719-32-6(CAS DataBase Reference) |
| EPA Substance Registry System | Benzonitrile, 4-isothiocyanato- (2719-32-6) |
Description and Uses
p-Cyanophenyl Isothiocyanate is an synthetic isothiocyanate derivative with potential anti-NF-kB and anti-inflammatory activities.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H314-H302-H312-H318-H331 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P405-P501a-P280-P305+P351+P338-P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | NX8479500 |
| Hazard Note | Corrosive/Lachrymatory/Keep cold |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29309090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
