A2516412
2-chloro-8-methylquinoline-3-carbaldehyde , ≥98% , 73568-26-0
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB44.00 | In Stock |
|
| 250MG | RMB50.40 | In Stock |
|
| 1G | RMB114.40 | In Stock |
|
| 5G | RMB340.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 138-141 °C (lit.) |
| Boiling point: | 350.8±37.0 °C(Predicted) |
| Density | 1.312±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | -1.29±0.50(Predicted) |
| form | Crystalline Powder |
| color | Yellow to yellow-brown |
| InChI | 1S/C11H8ClNO/c1-7-3-2-4-8-5-9(6-14)11(12)13-10(7)8/h2-6H,1H3 |
| InChIKey | YPBRSXNRWFUUOE-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1cc2cccc(C)c2nc1Cl |
| CAS DataBase Reference | 73568-26-0(CAS DataBase Reference) |
Description and Uses
2-Chloro-8-methylquinoline-3-carboxaldehyde acts as a reagent in the synthesis of 2-Azetidinones from 2-chloro-8-Me-3-quinolinecarbaldehyde as potential antimicrobial agents, preparation and antibacterial activity of thiazoloquinoline Schiff bases as potential antibacterial agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29334990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







