A2517712
Cytidine 5′-triphosphate disodium solution , ≥95% , 81012-87-5
Synonym(s):
5-CTP-Na2;CTP;CTP-Na2
CAS NO.：81012-87-5
Empirical Formula: C9H18N3Na2O16P3
Molecular Weight: 563.15
MDL number: MFCD00150807
EINECS: 815-308-8
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB159.20 | In Stock |
|
| 100MG | RMB386.40 | In Stock |
|
| 500mg | RMB1111.20 | In Stock |
|
| 1G | RMB1599.20 | In Stock |
|
| 5G | RMB5279.20 | In Stock |
|
| 10G | RMB7999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 215-218 °C |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | H2O: 50 mg/mL, clear, colorless |
| form | Crystalline Powder |
| color | colorless |
| Stability: | Hygroscopic |
| InChIKey | ZLCQKPRKZPUJJM-IROIDLSJNA-N |
| SMILES | O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O[C@H]1N1C=CC(N)=NC1=O)O.[NaH].O |&1:1,2,3,19,r| |
| CAS DataBase Reference | 81012-87-5(CAS DataBase Reference) |
Description and Uses
A disodium dihydrate form of CTP (CAS# 65-47-4) used in the radiolabeling of DNA restriction endonuclease fragments.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P261 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-37/39-36-26 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29349990 |
