PRODUCT Properties
| Melting point: | 42-45 °C (lit.) |
| Boiling point: | 370 °C (lit.) |
| Density | 1.10 |
| refractive index | 1.4800 (estimate) |
| FEMA | 2298 | CINNAMYL CINNAMATE |
| Flash point: | >230 °F |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | powder to lump to clear liquid |
| color | White or colourless crystals. |
| Odor | at 100.00 %. sweet balsam floral cassia cinnamyl |
| Odor Type | balsamic |
| biological source | synthetic |
| Merck | 14,2304 |
| JECFA Number | 673 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C18H16O2/c19-18(14-13-17-10-5-2-6-11-17)20-15-7-12-16-8-3-1-4-9-16/h1-14H,15H2/b12-7+,14-13+ |
| InChIKey | NQBWNECTZUOWID-MZXMXVKLSA-N |
| SMILES | O=C(OC\C=C\c1ccccc1)\C=C\c2ccccc2 |
| LogP | 4.45 |
| CAS DataBase Reference | 122-69-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Cinnamyl cinnamate(122-69-0) |
| EPA Substance Registry System | 2-Propenoic acid, 3-phenyl-, 3-phenyl-2-propenyl ester (122-69-0) |
Description and Uses
Perfumery, flavoring.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H332-H319-H360-H312 |
| Precautionary statements | P261-P271-P304+P340-P312-P264-P280-P305+P351+P338-P337+P313P-P280-P302+P352-P312-P322-P363-P501 |
| Safety Statements | 24/25 |
| WGK Germany | 2 |
| RTECS | GD8562000 |
| TSCA | TSCA listed |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | The acute oral LD50 value for cinnamyl cinnamate in rats was reported as 4.2 g/kg, and the acute dermal LD50 value was greater than 5 g/kg (Wohl, 1974). |





