A2521012
3-(4-Chlorophenyl)propionic acid , ≥97% , 2019-34-3
Synonym(s):
p-Chlorohydrocinnamic acid
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB97.60 | In Stock |
|
| 25G | RMB363.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 127-131 °C (lit.) |
| Boiling point: | 263.86°C (rough estimate) |
| Density | 1.1989 (rough estimate) |
| refractive index | 1.5242 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.61(at 25℃) |
| form | solid |
| color | White to off white |
| InChI | InChI=1S/C9H9ClO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-2,4-5H,3,6H2,(H,11,12) |
| InChIKey | BBSLOKZINKEUCR-UHFFFAOYSA-N |
| SMILES | C1(CCC(O)=O)=CC=C(Cl)C=C1 |
| CAS DataBase Reference | 2019-34-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-(4-Chlorophenyl)propionic acid(2019-34-3) |
Description and Uses
3-(4-Chlorophenyl)propanoic acid is an intermediate of the herbicide methylphenidate.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P301+P312+P330-P305+P351+P338+P310 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-41 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 2 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |





