A2522812
3-(Chlorosulfonyl)benzoic acid , ≥97% , 4025-64-3
CAS NO.:4025-64-3
Empirical Formula: C7H5ClO4S
Molecular Weight: 220.63
MDL number: MFCD00024877
EINECS: 223-692-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB74.40 | In Stock |
|
| 25G | RMB180.80 | In Stock |
|
| 100G | RMB556.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128-130 °C(lit.) |
| Boiling point: | 402.5±28.0 °C(Predicted) |
| Density | 1.591±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Methanol[soluble in] |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.00±0.10(Predicted) |
| color | White to Brown |
| Sensitive | Moisture Sensitive |
| BRN | 2645465 |
| InChI | 1S/C7H5ClO4S/c8-13(11,12)6-3-1-2-5(4-6)7(9)10/h1-4H,(H,9,10) |
| InChIKey | LMRKXSDOAFUINK-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cccc(c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 4025-64-3(CAS DataBase Reference) |
| NIST Chemistry Reference | M-(chlorosulfonyl)benzoic acid(4025-64-3) |
| EPA Substance Registry System | Benzoic acid, 3-(chlorosulfonyl)- (4025-64-3) |
Description and Uses
3-(Chlorosulfonyl)benzoic acid is a sulfonyl halide. It participates in the synthesis of novel anthranilic acid class of PPARδ (Peroxisome proliferator-activated receptor δ) partial agonists.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34-29-22 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |




