A2523612
Cyanidin chloride , Analysis of standard products, ≥98%(HPLC) , 528-58-5
Synonym(s):
3,3′,4,5,7-Pentahydroxyflavylium chloride;Cyanidol chloride
CAS NO.：528-58-5
Empirical Formula: C15H11ClO6
Molecular Weight: 322.7
MDL number: MFCD00017582
EINECS: 208-438-6
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB828.00 | In Stock |
|
| 20mg | RMB1420.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C |
| Boiling point: | 349.55°C (rough estimate) |
| Density | 1.2843 (rough estimate) |
| refractive index | 1.4413 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO |
| form | Solid |
| color | Brown |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C15H10O6.ClH/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7;/h1-6H,(H4-,16,17,18,19,20);1H |
| InChIKey | COAWNPJQKJEHPG-UHFFFAOYSA-N |
| SMILES | C1(=C(O)C=C2C(O)=CC(O)=CC2=[O+]1)C1C=CC(O)=C(O)C=1.[Cl-] |
| CAS DataBase Reference | 528-58-5(CAS DataBase Reference) |
Description and Uses
Cyanidin Chloride is a flavonoid compound that protects neuronal cells from oxidative stress. Present in tart cherries, it also contributes to antiinflammatory and antioxidant activities.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | LK9824000 |
| F | 10-21 |
| HS Code | 29329990 |
