PRODUCT Properties
| Melting point: | 23-24 °C(lit.) |
| Boiling point: | 419.84°C (estimate) |
| Density | 0.883 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Solid |
| pka | 4.78±0.10(Predicted) |
| color | White to Off-White |
| biological source | plant oil (Jojoba) |
| BRN | 1727313 |
| Cosmetics Ingredients Functions | HAIR CONDITIONING |
| InChI | 1S/C20H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h9-10H,2-8,11-19H2,1H3,(H,21,22)/b10-9- |
| InChIKey | BITHHVVYSMSWAG-KTKRTIGZSA-N |
| SMILES | CCCCCCCC\C=C/CCCCCCCCCC(O)=O |
| LogP | 8.760 (est) |
| CAS DataBase Reference | 5561-99-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Cis-11-eicosenoic acid(5561-99-9) |
Description and Uses
Gondoic acid is a mono unsaturated omega-9 fatty acid found in a variety of plant oils and nuts. It is the main acid component of jojoba oil.
(11Z)-11-Eicosenoic Acid, is a monostaturated fatty acid. The combined C20:1 isomers constitute 70% of the total fatty acid pool in jojoba seed oil isolated from plants in the Arizona desert.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H319 |
| Precautionary statements | P210-P233-P240-P241-P242-P243-P264-P280-P303+P361+P353-P305+P351+P338-P337+P313-P370+P378-P403+P235-P501 |
| PPE | Eyeshields, Gloves |
| WGK Germany | 3 |
| F | 8-10 |
| Storage Class | 10 - Combustible liquids |
