A2525912
3-Cyanophenol , ≥98% , 873-62-1
Synonym(s):
3-Hydroxybenzonitrile
CAS NO.:873-62-1
Empirical Formula: C7H5NO
Molecular Weight: 119.12
MDL number: MFCD00002252
EINECS: 212-845-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB76.80 | In Stock |
|
| 25G | RMB214.40 | In Stock |
|
| 100g | RMB601.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78-81 °C(lit.) |
| Boiling point: | 222.38°C (rough estimate) |
| Density | 1.1871 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| pka | 8.61(at 25℃) |
| color | Almost white to light brown |
| Water Solubility | Slightly soluble in water. |
| BRN | 2041515 |
| InChI | InChI=1S/C7H5NO/c8-5-6-2-1-3-7(9)4-6/h1-4,9H |
| InChIKey | SGHBRHKBCLLVCI-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC(O)=C1 |
| CAS DataBase Reference | 873-62-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Hydroxybenzoic acid nitrile(873-62-1) |
Description and Uses
3-Hydroxybenzonitrile, is an intermediate that can be used for the synthesis of new Serotonin 5-HT1A receptor agonists having antinociceptive activity in vivo.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-20/21/22 |
| Safety Statements | 26-36-45-36/37/39 |
| RIDADR | 3276 |
| WGK Germany | 2 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29089990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





