A2526712
4-Chloro-N-methylaniline , ≥96% , 932-96-7
CAS NO.:932-96-7
Empirical Formula: C7H8ClN
Molecular Weight: 141.6
MDL number: MFCD00000614
EINECS: 213-262-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB40.80 | In Stock |
|
| 5G | RMB125.60 | In Stock |
|
| 25G | RMB500.80 | In Stock |
|
| 100G | RMB1880.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 239 °C (lit.) |
| Density | 1.169 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 125 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | pK1: 3.9(+1) (25°C) |
| form | liquid |
| Appearance | Light yellow to yellow Liquid |
| BRN | 2205846 |
| InChI | InChI=1S/C7H8ClN/c1-9-7-4-2-6(8)3-5-7/h2-5,9H,1H3 |
| InChIKey | XCEYKKJMLOFDSS-UHFFFAOYSA-N |
| SMILES | C1(NC)=CC=C(Cl)C=C1 |
| CAS DataBase Reference | 932-96-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 4-chloro-N-methyl-(932-96-7) |
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() ![]() GHS02,GHS05,GHS07,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H315-H319-H302-H312-H331-H373-H226-H318-H335-H412 |
| Precautionary statements | P210-P233-P240-P241+P242+P243-P264-P270-P271-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P403+P235-P501-P260-P304+P340-P405-P501a-P261-P273-P280-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 10-36/37-36/37/38-20/21/22 |
| Safety Statements | 16-26-36/37/39 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| RTECS | CX9857900 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Chronic 3 Eye Dam. 1 Flam. Liq. 3 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |









