A2527012
4-Chloro-3-nitrophenyl methyl sulfone , ≥98.0%(GC) , 97-07-4
CAS NO.:97-07-4
Empirical Formula: C7H6ClNO4S
Molecular Weight: 235.64
MDL number: MFCD00039754
EINECS: 202-557-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB59.20 | In Stock |
|
| 5G | RMB188.80 | In Stock |
|
| 25G | RMB1048.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 123.0 to 127.0 °C |
| Boiling point: | 414.2±45.0 °C(Predicted) |
| Density | 1.520±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Off-White to Pale Beige |
| InChI | InChI=1S/C7H6ClNO4S/c1-14(12,13)5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
| InChIKey | JAANTSGNTKWLFA-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(S(C)(=O)=O)C=C1[N+]([O-])=O |
| CAS DataBase Reference | 97-07-4(CAS DataBase Reference) |
| EPA Substance Registry System | Benzene, 1-chloro-4-(methylsulfonyl)-2-nitro- (97-07-4) |
Description and Uses
1-Chloro-4-(methylsulfonyl)-2-nitrobenzene is a potential antifungal agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P261-P280 |
| HS Code | 2930909899 |




