A2527312
1-Chloroethyl Cyclohexyl Carbonate , ≥98.0%(GC) , 99464-83-2
CAS NO.：99464-83-2
Empirical Formula: C9H15ClO3
Molecular Weight: 206.67
MDL number: MFCD04038149
EINECS: 444-950-8
| Pack Size | Price | Stock | Quantity |
| 50G | RMB95.20 | In Stock |
|
| 100G | RMB158.40 | In Stock |
|
| 250G | RMB343.20 | In Stock |
|
| 500G | RMB606.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 283.9±19.0 °C(Predicted) |
| Density | 1.13±0.1 g/cm3(Predicted) |
| refractive index | 1.4540-1.4580 |
| Flash point: | 84 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Ethyl Acetate, Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C9H15ClO3/c1-7(10)12-9(11)13-8-5-3-2-4-6-8/h7-8H,2-6H2,1H3 |
| InChIKey | ONZWFHWHTYZZLM-UHFFFAOYSA-N |
| SMILES | C(OC1CCCCC1)(=O)OC(Cl)C |
| CAS DataBase Reference | 99464-83-2(CAS DataBase Reference) |
Description and Uses
1-Chloroethyl Cyclohexyl Carbonate is a genotoxic impurity used in the synthesis of Candesartan Cilexetil. an angiotensin II receptor antagonist.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P264-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 1760 |
| HS Code | 2915.90.5010 |
| HazardClass | 8 |
| PackingGroup | II |
