PRODUCT Properties
| Melting point: | 52-56 °C |
| Boiling point: | 133 °C / 7mmHg |
| Density | 1.404±0.06 g/cm3(Predicted) |
| Flash point: | 110 °C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | 0.53±0.10(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C8H6ClNOS/c1-11-5-2-3-6-7(4-5)12-8(9)10-6/h2-4H,1H3 |
| InChIKey | FVUFTABOJFRHSU-UHFFFAOYSA-N |
| SMILES | S1C2=CC(OC)=CC=C2N=C1Cl |
| CAS DataBase Reference | 2605-14-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36 |
| Safety Statements | 22-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
