A2546212
4-Chloro-2-hydroxybenzaldehyde , >95.0% , 2420-26-0
CAS NO.：2420-26-0
Empirical Formula: C7H5ClO2
Molecular Weight: 156.57
MDL number: MFCD06252499
EINECS: 695-765-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB33.68 | In Stock |
|
| 1G | RMB57.60 | In Stock |
|
| 5G | RMB165.60 | In Stock |
|
| 25g | RMB581.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45.0 to 49.0 °C |
| Boiling point: | 229.1±20.0 °C(Predicted) |
| Density | 1.404±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Solid |
| pka | 7.21±0.10(Predicted) |
| color | Off-White to Pale Brown |
| InChI | InChI=1S/C7H5ClO2/c8-6-2-1-5(4-9)7(10)3-6/h1-4,10H |
| InChIKey | QNZWAJZEJAOVPN-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(Cl)C=C1O |
| CAS DataBase Reference | 2420-26-0 |
Description and Uses
4-Chloro-2-hydroxybenzaldehyde is an intermediate used to prepare benzodiazepine diones as Hdm2 antagonists. It is also used to synthesize hydroxy-dimethyl-oxo-cyclohexenyl-dimethyl-tetrahydro-xanthenone as oral neuropeptide Y5 receptor antagonist.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| HS Code | 2913000090 |
