A2568812
1,2-Cyclohexanediol (<i>cis</i>- and <i>trans</i>- mixture) , >98.0%(GC) , 931-17-9
CAS NO.：931-17-9
Empirical Formula: C6H12O2
Molecular Weight: 116.16
MDL number: MFCD00003861
EINECS: 213-229-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB29.60 | In Stock |
|
| 5g | RMB121.60 | In Stock |
|
| 10g | RMB223.20 | In Stock |
|
| 25G | RMB378.40 | In Stock |
|
| 100G | RMB758.40 | In Stock |
|
| 500G | RMB3038.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 73-77 °C |
| Boiling point: | 118-120 °C (10 mmHg) |
| Density | 0.9958 (rough estimate) |
| refractive index | 1.4270 (estimate) |
| Flash point: | 118-120°C/10mm |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 14.49±0.40(Predicted) |
| form | Crystalline Powder |
| color | White to off-white |
| Water Solubility | Soluble |
| InChI | InChI=1S/C6H12O2/c7-5-3-1-2-4-6(5)8/h5-8H,1-4H2 |
| InChIKey | PFURGBBHAOXLIO-UHFFFAOYSA-N |
| SMILES | C1(O)CCCCC1O |
| CAS DataBase Reference | 931-17-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,2-Cyclohexanediol(931-17-9) |
Description and Uses
1,2-Cyclohexanediol is used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25-23 |
| RTECS | GV0220000 |
| HS Code | 29061990 |
