A2569512
1,3-Cyclohexanediamine (<i>cis</i>- and <i>trans</i>- mixture) , >95.0%(GC) , 3385-21-5
CAS NO.:3385-21-5
Empirical Formula: C6H14N2
Molecular Weight: 114.19
MDL number: MFCD00059563
EINECS: 222-194-8
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB207.20 | In Stock |
|
| 5ML | RMB647.20 | In Stock |
|
| 25ML | RMB1724.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 194°C(lit.) |
| Density | 0.95 |
| refractive index | 1.49 |
| storage temp. | 2-8°C, protect from light |
| pka | 10.70±0.70(Predicted) |
| form | Liquid |
| color | Clear pale yellow |
| Specific Gravity | 0.95 |
| InChI | InChI=1S/C6H14N2/c7-5-2-1-3-6(8)4-5/h5-6H,1-4,7-8H2 |
| InChIKey | GEQHKFFSPGPGLN-UHFFFAOYSA-N |
| SMILES | C1(N)CCCC(N)C1 |
| EPA Substance Registry System | 1,3-Cyclohexanediamine (3385-21-5) |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H227-H302-H314 |
| Precautionary statements | P210-P260-P264-P270-P280-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P370+P378-P403+P235-P405-P501 |
| Hazard Codes | C,Xn |
| Risk Statements | 34-20/21/22-36-22 |
| Safety Statements | 45-36/37/39-26 |
| RIDADR | 2735 |
| WGK Germany | 3 |
| RTECS | GU8750000 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29213000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







