PRODUCT Properties
| Melting point: | 125-128 °C (lit.) |
| Boiling point: | 308.8±27.0 °C(Predicted) |
| Density | 1.554±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 7.70±0.10(Predicted) |
| form | Crystalline Powder |
| color | brown |
| BRN | 2094546 |
| InChI | 1S/C6H4ClNO3/c7-5-2-1-4(9)3-6(5)8(10)11/h1-3,9H |
| InChIKey | JUIKCULGDIZNDI-UHFFFAOYSA-N |
| SMILES | Oc1ccc(Cl)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 610-78-6(CAS DataBase Reference) |
Description and Uses
4-Chloro-3-nitrophenol may be used as sole carbon and energy supplement for Pseudomonas sp. JHN.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-36/37/381 |
| Safety Statements | 26-36-36/37/39 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29089000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
