A2587912
4-Chloro-6-methyl-2-(methylthio)pyrimidine , >98.0%(GC) , 17119-73-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB88.80 | In Stock |
|
| 5G | RMB225.60 | In Stock |
|
| 10g | RMB389.60 | In Stock |
|
| 25g | RMB724.80 | In Stock |
|
| 100g | RMB2679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 37-38℃ |
| Boiling point: | 147°C/32mmHg(lit.) |
| Density | 1.30±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Sparingly), MEthanol (Slightly) |
| form | Solid |
| pka | 0.16±0.30(Predicted) |
| color | Pale Yellow |
| InChI | InChI=1S/C6H7ClN2S/c1-4-3-5(7)9-6(8-4)10-2/h3H,1-2H3 |
| InChIKey | ALMBOXQFPLQVLF-UHFFFAOYSA-N |
| SMILES | C1(SC)=NC(C)=CC(Cl)=N1 |
Description and Uses
4-Chloro-6-methyl-2-(methylthio)pyrimidine has been used in the synthesis of 4-chloro-2-(3,5-dimethyl-1h-pyrazol-1-yl)-6-methylpyrimidine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Risk Statements | 22 |
| Safety Statements | 36/37 |
| HS Code | 29339900 |
