A2596812
9-Cyanoanthracene , >95.0%(HPLC) , 1210-12-4
Synonym(s):
9-Cyanoanthracene
CAS NO.:1210-12-4
Empirical Formula: C15H9N
Molecular Weight: 203.24
MDL number: MFCD00001242
EINECS: 214-909-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB63.20 | In Stock |
|
| 5G | RMB255.20 | In Stock |
|
| 25G | RMB1103.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 173-177 °C(lit.) |
| Boiling point: | 413.8±14.0 °C(Predicted) |
| Density | 1.20±0.1 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| form | powder |
| Appearance | Light yellow to yellow Solid |
| Water Solubility | Insoluble in water. |
| BRN | 1911437 |
| InChI | InChI=1S/C15H9N/c16-10-15-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)15/h1-9H |
| InChIKey | KEQZHLAEKAVZLY-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C3C(=C2C#N)C=CC=C3)=CC=C1 |
| CAS DataBase Reference | 1210-12-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 9-Anthracenecarbonitrile(1210-12-4) |
| EPA Substance Registry System | 9-Anthracenecarbonitrile (1210-12-4) |
Description and Uses
Anthracene-9-carbonitrile was used to study the mechanism of charge separation within phenothiazine (PTZH) or phenoxazine (PXZH), and 9-cyanoanthracene(electron acceptor). Also it has been used to study the fluorescence excitation spectra of this compound .
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2926907090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |






