A2601312
2-Chloroethyl <i>p</i>-Toluenesulfonate , >98.0%(GC) , 80-41-1
CAS NO.：80-41-1
Empirical Formula: C9H11ClO3S
Molecular Weight: 234.7
MDL number: MFCD00000970
EINECS: 201-277-2
| Pack Size | Price | Stock | Quantity |
| 25G | RMB319.20 | In Stock |
|
| 100G | RMB1039.20 | In Stock |
|
| 500g | RMB3639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 157-161℃ |
| Boiling point: | 153 °C0.3 mm Hg(lit.) |
| Density | 1.294 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless to yellow |
| BRN | 1968816 |
| InChI | 1S/C9H11ClO3S/c1-8-2-4-9(5-3-8)14(11,12)13-7-6-10/h2-5H,6-7H2,1H3 |
| InChIKey | ZXNMIUJDTOMBPV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1)S(=O)(=O)OCCCl |
| CAS DataBase Reference | 80-41-1(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanol, 2-chloro-, 4-methylbenzenesulfonate (80-41-1) |
Description and Uses
2-Chloroethyl p-toluenesulfonate was used to develop method for the determination of a variety of hydrophobic aromatic sulfonates by micellar electrokinetic chromatography.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H320-H302 |
| Precautionary statements | P280f-P264-P270-P301+P312+P330-P305+P351+P338+P337+P313-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 23-36/37/39-24/25 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| RTECS | XT6475000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29055900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral |
