A2601912
4-Cyanobenzoyl Chloride , >98.0%(GC) , 6068-72-0
CAS NO.:6068-72-0
Empirical Formula: C8H4ClNO
Molecular Weight: 165.58
MDL number: MFCD00001822
EINECS: 228-005-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB128.00 | In Stock |
|
| 10g | RMB217.60 | In Stock |
|
| 25G | RMB424.00 | In Stock |
|
| 100g | RMB1551.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 68-70 °C(lit.) |
| Boiling point: | 110 °C / 2mmHg |
| Density | 1.2744 (rough estimate) |
| refractive index | 1.5430 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| color | Almost white to beige |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| BRN | 386729 |
| InChI | InChI=1S/C8H4ClNO/c9-8(11)7-3-1-6(5-10)2-4-7/h1-4H |
| InChIKey | USEDMAWWQDFMFY-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC=C(C#N)C=C1 |
| CAS DataBase Reference | 6068-72-0(CAS DataBase Reference) |
Description and Uses
4-Cyanobenzoyl chloride has been used in the synthesis of new liquid crystalline heteroaromatic compounds containing the five-membered isoxazole, tetrazole and 1,2,4-oxadiazole rings. It has been used in the synthesis of substituted benzoate esters and to study their excited-state behavior.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-24/25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29269090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |



