A2602212
5-Chloro-1-methylimidazole , >98.0%(GC) , 872-49-1
CAS NO.：872-49-1
Empirical Formula: C4H5ClN2
Molecular Weight: 116.55
MDL number: MFCD00014505
EINECS: 212-827-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB47.20 | In Stock |
|
| 1g | RMB111.20 | In Stock |
|
| 5G | RMB365.60 | In Stock |
|
| 25G | RMB1250.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82-85°C(11 mmHg) |
| Boiling point: | 82-85 °C/11 mmHg (lit.) |
| Density | 1.25 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 205 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in chloroform and insoluble in water |
| pka | 5.31±0.10(Predicted) |
| form | Oil |
| color | Colorless to yellow to brown liquid |
| Water Solubility | insoluble |
| BRN | 110509 |
| InChI | InChI=1S/C4H5ClN2/c1-7-3-6-2-4(7)5/h2-3H,1H3 |
| InChIKey | NYDGOZPYEABERA-UHFFFAOYSA-N |
| SMILES | C1N(C)C(Cl)=CN=1 |
| CAS DataBase Reference | 872-49-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Chloro-1-methylimidazole(872-49-1) |
Description and Uses
5-Chloro-1-methylimidazole is a labelled useful synthetic intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933299090 |
