A2607312
                    2-Cyano-<i>N</i>,<i>N</i>-diethylacetamide , >98.0%(GC) , 26391-06-0
                            Synonym(s):
N,N-Diethylcyanoacetamide;2-Cyano-N,N-diethylacetamide
                            
                        
                | Pack Size | Price | Stock | Quantity | 
| 1G | RMB23.20 | In Stock | 
                                                 | 
                                        
| 5G | RMB35.20 | In Stock | 
                                                 | 
                                        
| 25G | RMB52.00 | In Stock | 
                                                 | 
                                        
| 100g | RMB165.60 | In Stock | 
                                                 | 
                                        
| 500G | RMB635.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 121 °C | 
                                    
| Boiling point: | 114°C/4mmHg(lit.) | 
                                    
| Density | 1.013 g/mL at 25 °C | 
                                    
| refractive index | n20/D1.466 | 
                                    
| Flash point: | >110℃ | 
                                    
| storage temp. | 2-8°C | 
                                    
| solubility | Chloroform, Ethyl Acetate, Tetrahydrofuran, Methanol | 
                                    
| pka | 4.53±0.10(Predicted) | 
                                    
| form | Oil | 
                                    
| color | Light Yellow to Light Brown | 
                                    
| InChI | InChI=1S/C7H12N2O/c1-3-9(4-2)7(10)5-6-8/h3-5H2,1-2H3 | 
                                    
| InChIKey | RYSHIRFTLKZVIH-UHFFFAOYSA-N | 
                                    
| SMILES | C(N(CC)CC)(=O)CC#N | 
                                    
| CAS DataBase Reference | 26391-06-0(CAS DataBase Reference) | 
                                    
Description and Uses
                                            N,N-Diethyl-2-cyanoacetoamide can be used:
- To prepare N,N-diethyl 2-cyano-2-fluoro-2-phenylthioacetoamide, which is further used in the synthesis of various cyanofluoroamides.
 - In the synthesis of entacapone, a catechol-O-methyltransferase inhibitor by reacting with 3,4-dihydroxy-5-nitrobenzaldehyde.
 - As a building block in the synthesis of fluorophores, applicable as endoplasmic reticulum probes.
 
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302+H312+H332-H315-H319 | 
| Precautionary statements | P501-P261-P270-P271-P264-P280-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330-P302+P352+P312-P304+P340+P312 | 
| WGK Germany | 3 | 
| HazardClass | IRRITANT | 
| HS Code | 2926907090 | 







