A2608212
1-Cyclopentenecarboxylic Acid , >98.0%(HPLC) , 1560-11-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB136.80 | In Stock |
|
| 5G | RMB512.80 | In Stock |
|
| 10G | RMB1016.80 | In Stock |
|
| 25G | RMB2041.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 121-124 °C (lit.) |
| Boiling point: | 210°C |
| Density | 1.0795 (rough estimate) |
| refractive index | 1.4570 (estimate) |
| Flash point: | 210°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 5.00±0.20(Predicted) |
| form | Solid |
| color | White to Off-White |
| BRN | 1446347 |
| InChI | InChI=1S/C6H8O2/c7-6(8)5-3-1-2-4-5/h3H,1-2,4H2,(H,7,8) |
| InChIKey | PYRZPBDTPRQYKG-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)CCCC=1 |
| CAS DataBase Reference | 1560-11-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 1-Cyclopentene-1-carboxylic acid(1560-11-8) |
Description and Uses
1-Cyclopentenecarboxylic acid was used in synthesis of cis-8-hexahydroindanecarboxylic acid via Diels-Alder reaction with butadiene. It was also used in synthesis of isoxazole derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| RTECS | GY5976100 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29162090 |
