A2608312
<i>cis</i>-4-Aminocyclohexanecarboxylic Acid , >98.0% , 3685-23-2
CAS NO.：3685-23-2
Empirical Formula: C7H13NO2
Molecular Weight: 143.18
MDL number: MFCD00191730
EINECS: 626-259-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB41.60 | In Stock |
|
| 1G | RMB114.40 | In Stock |
|
| 5G | RMB308.00 | In Stock |
|
| 10G | RMB548.80 | In Stock |
|
| 25G | RMB1264.00 | In Stock |
|
| 100G | RMB4576.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 299-301 °C(lit.) |
| Boiling point: | 280.0±33.0 °C(Predicted) |
| Density | 9 g/cm3 |
| storage temp. | Inert atmosphere,Room Temperature |
| Water Solubility | Soluble in water |
| solubility | Methanol (Very Slightly), Water (Sparingly) |
| form | Powder |
| pka | 4.62±0.25(Predicted) |
| color | Off-white |
| InChI | InChI=1S/C7H13NO2/c8-6-3-1-5(2-4-6)7(9)10/h5-6H,1-4,8H2,(H,9,10)/t5-,6+ |
| InChIKey | DRNGLYHKYPNTEA-OLQVQODUSA-N |
| SMILES | [C@@H]1(C(O)=O)CC[C@H](N)CC1 |
| CAS DataBase Reference | 3685-23-2(CAS DataBase Reference) |
Description and Uses
cis-4-Aminocyclohexanecarboxylic Acid is used as a reagent in the synthesis of thiazolylquinazolines
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29224999 |
