A2614312
2-Chloro-1-(dimethylamino)propane Hydrochloride , >98.0%(T) , 4584-49-0
Synonym(s):
β-(Dimethylamino)isopropyl chloride hydrochloride;N-(2-Chloropropyl)dimethylamine hydrochloride;2-(Dimethylamino)isopropyl chloride hydrochloride;2-Chloro-1-(dimethylamino)propane hydrochloride
CAS NO.:4584-49-0
Empirical Formula: C5H13Cl2N
Molecular Weight: 158.07
MDL number: MFCD00012534
EINECS: 224-971-7
| Pack Size | Price | Stock | Quantity |
| 25G | RMB58.40 | In Stock |
|
| 100G | RMB133.60 | In Stock |
|
| 500G | RMB435.20 | In Stock |
|
| 2.5kg | RMB2015.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 187-190 °C(lit.) |
| bulk density | 350kg/m3 |
| storage temp. | Store below +30°C. |
| solubility | 2000g/l |
| form | Crystalline Powder |
| color | White to light cream |
| PH | 5-6 (500g/l, H2O, 20℃) |
| Water Solubility | 2000 g/L (20 º C) |
| Sensitive | Hygroscopic |
| BRN | 3670215 |
| InChI | InChI=1S/C5H12ClN.ClH/c1-5(6)4-7(2)3;/h5H,4H2,1-3H3;1H |
| InChIKey | OCWGRWAYARCRTQ-UHFFFAOYSA-N |
| SMILES | C(Cl)(C)CN(C)C.Cl |
| CAS DataBase Reference | 4584-49-0(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Chloro-N,N-dimethyl-1-propanamine hydrochloride (4584-49-0) |
Description and Uses
2-Chloro-N,N-dimethylpropylamine hydrochloride (DMIC) is used as intermediate for the syntheses of pharmaceuticals (e.g. isothipendyl, methadone and promethazine)
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | TY1225000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29211980 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




