A2616712
4-Cyanobenzyl Bromide , >98.0%(GC) , 17201-43-3
Synonym(s):
α-Bromo-p-tolunitrile;4-Cyanobenzyl bromide
CAS NO.:17201-43-3
Empirical Formula: C8H6BrN
Molecular Weight: 196.04
MDL number: MFCD00001829
EINECS: 241-246-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB124.80 | In Stock |
|
| 100G | RMB411.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-117 °C(lit.) |
| Boiling point: | 143 °C / 12mmHg |
| Density | 1.5466 (rough estimate) |
| refractive index | 1.6550 (estimate) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless to yellow |
| Water Solubility | Soluble in chloroform and methanol. Insoluble in water. |
| BRN | 636717 |
| InChI | InChI=1S/C8H6BrN/c9-5-7-1-3-8(6-10)4-2-7/h1-4H,5H2 |
| InChIKey | UMLFTCYAQPPZER-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(CBr)C=C1 |
| CAS DataBase Reference | 17201-43-3(CAS DataBase Reference) |
| NIST Chemistry Reference | «ALPHA»-bromo-p-tolunitrile(17201-43-3) |
| EPA Substance Registry System | Benzonitrile, 4-(bromomethyl)- (17201-43-3) |
Description and Uses
4-(Bromomethyl)benzonitrile may be used in the synthesis of ligands containing a chelating pyrazolyl-pyridine group with a pendant aromatic nitrile.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H314-H334 |
| Precautionary statements | P260-P280-P284-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34-42/43 |
| Safety Statements | 22-26-36/37/39-45-28A |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-19-21 |
| Hazard Note | Corrosive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29269090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Resp. Sens. 1 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |








