A2628812
2-(4-Chlorophenyl)ethylamine , ≥98.0% , 156-41-2
Synonym(s):
4-Chlorophenethylamine
CAS NO.：156-41-2
Empirical Formula: C8H10ClN
Molecular Weight: 155.62
MDL number: MFCD00008191
EINECS: 205-853-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB57.60 | In Stock |
|
| 25G | RMB156.00 | In Stock |
|
| 100G | RMB399.20 | In Stock |
|
| 500g | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 60-65 °C0.1 mm Hg(lit.) |
| Density | 1.112 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 223 °F |
| storage temp. | Store Cold |
| pka | 9.72±0.10(Predicted) |
| form | Liquid |
| color | Clear colorless to yellow |
| Specific Gravity | 1.12 |
| BRN | 508247 |
| InChI | InChI=1S/C8H10ClN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5-6,10H2 |
| InChIKey | SRXFXCKTIGELTI-UHFFFAOYSA-N |
| SMILES | C1(CCN)=CC=C(Cl)C=C1 |
| CAS DataBase Reference | 156-41-2(CAS DataBase Reference) |
Description and Uses
2-(4-Chlorophenyl)ethylamine has been used as a reactant in the preparation of isoalloxazine derivatives as cholinesterase inhibitors with a potential use in Alzheimer therapy.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,C,T |
| Risk Statements | 36/37/38-34 |
| Safety Statements | 26-36-45-36/37/39 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | IRRITANT |
| HS Code | 29214990 |
