A2631212
4-Chlorobenzenesulfonyl Chloride , >98.0%(T) , 98-60-2
CAS NO.：98-60-2
Empirical Formula: C6H4Cl2O2S
Molecular Weight: 211.07
MDL number: MFCD00007439
EINECS: 202-685-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB34.40 | In Stock |
|
| 100G | RMB102.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 50-52 °C (lit.) |
| Boiling point: | 141 °C/15 mmHg (lit.) |
| Density | 1.5075 (estimate) |
| Flash point: | 226 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Toluene |
| form | Liquid |
| color | Clear |
| Water Solubility | INSOLUBLE |
| Sensitive | Moisture Sensitive |
| BRN | 511583 |
| InChI | InChI=1S/C6H4Cl2O2S/c7-5-1-3-6(4-2-5)11(8,9)10/h1-4H |
| InChIKey | ZLYBFBAHAQEEQQ-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC=C(Cl)C=C1 |
| CAS DataBase Reference | 98-60-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Chlorobenzenesulfonyl chloride(98-60-2) |
| EPA Substance Registry System | Benzenesulfonyl chloride, 4-chloro- (98-60-2) |
Description and Uses
4-Chlorobenzenesulfonyl chloride was used in the synthesis of precursors for the 3,4-pyridyne generation.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C |
| Risk Statements | 34-37 |
| Safety Statements | 26-28-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 2 |
| RTECS | DB8925000 |
| F | 21 |
| Hazard Note | Corrosive |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049020 |
| Hazardous Substances Data | 98-60-2(Hazardous Substances Data) |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
