A2631812
1-Cyclohexylpiperazine , >98.0%(GC) , 17766-28-8
CAS NO.:17766-28-8
Empirical Formula: C10H20N2
Molecular Weight: 168.28
MDL number: MFCD00044809
EINECS: 241-750-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB46.40 | In Stock |
|
| 5G | RMB173.60 | In Stock |
|
| 25G | RMB736.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 28-32 °C |
| Boiling point: | 287.25°C (rough estimate) |
| Density | 0.9725 (rough estimate) |
| refractive index | 1.6011 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Low Melting Solid |
| pka | 9.25±0.10(Predicted) |
| color | Yellow-brownish |
| BRN | 106845 |
| InChI | InChI=1S/C10H20N2/c1-2-4-10(5-3-1)12-8-6-11-7-9-12/h10-11H,1-9H2 |
| InChIKey | XPDSXKIDJNKIQY-UHFFFAOYSA-N |
| SMILES | N1(C2CCCCC2)CCNCC1 |
| CAS DataBase Reference | 17766-28-8(CAS DataBase Reference) |
Description and Uses
1-Cyclohexylpiperazine is an σ1 and σ2 receptor ligands with diagnostic and therapeutic potentials.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29335990 |






