A2631912
1-Carbobenzoxypiperazine , >95.0%(GC) , 31166-44-6
Synonym(s):
1-(Benzyloxycarbonyl)piperazine;1-Cbz-Piperazine;Benzyl piperazine-1-carboxylate
CAS NO.:31166-44-6
Empirical Formula: C12H16N2O2
Molecular Weight: 220.27
MDL number: MFCD00274317
EINECS: 629-513-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB28.00 | In Stock |
|
| 25G | RMB99.20 | In Stock |
|
| 100G | RMB368.00 | In Stock |
|
| 500g | RMB1839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 158-161 °C1.4 mm Hg(lit.) |
| Density | 1.142 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), Methanol (Sparingly) |
| pka | 8.44±0.10(Predicted) |
| form | Oil |
| color | Clear Colourless to Pale Yellow |
| BRN | 179500 |
| InChI | InChI=1S/C12H16N2O2/c15-12(14-8-6-13-7-9-14)16-10-11-4-2-1-3-5-11/h1-5,13H,6-10H2 |
| InChIKey | CTOUWUYDDUSBQE-UHFFFAOYSA-N |
| SMILES | N1(C(OCC2=CC=CC=C2)=O)CCNCC1 |
| CAS DataBase Reference | 31166-44-6(CAS DataBase Reference) |
Description and Uses
1-Cbz-piperazine is used in the synthesis of serotonin 5-HT6 and dopamine D2 receptor ligands (1,2). It can also be used for the synthesis of a 11-C labelled ligands for imaging vesicular acetylcholine transporter.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-23 |
| HS Code | 29335990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







