A2633712
<i>cis</i>-3-(<i>tert</i>-Butoxycarbonylamino)cyclohexanecarboxylic Acid , >97.0% , 222530-33-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB31.20 | In Stock |
|
| 250mg | RMB47.20 | In Stock |
|
| 1G | RMB115.20 | In Stock |
|
| 5G | RMB345.60 | In Stock |
|
| 10g | RMB404.80 | In Stock |
|
| 25g | RMB868.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 143-147℃ |
| Boiling point: | 396.7±31.0 °C(Predicted) |
| Density | 1.12±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.62±0.10(Predicted) |
| color | White to Almost white |
| Major Application | peptide synthesis |
| InChI | InChI=1/C12H21NO4/c1-12(2,3)17-11(16)13-9-6-4-5-8(7-9)10(14)15/h8-9H,4-7H2,1-3H3,(H,13,16)(H,14,15)/t8-,9+/s3 |
| InChIKey | JSGHMGKJNZTKGF-MASDURLHNA-N |
| SMILES | [C@@H]1(C(O)=O)CCC[C@H](NC(OC(C)(C)C)=O)C1 |&1:0,7,r| |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 13 - Non Combustible Solids |







