A2635812
Cyclopentadienyltitanium(IV) Trichloride , 97% , 1270-98-0
Synonym(s):
CpTiCl3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB351.20 | In Stock |
|
| 5G | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210 °C (dec.) (lit.) |
| refractive index | 1.47 |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| form | Crystalline |
| color | Yellow-orange |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | 1S/C5H5.3ClH.Ti/c1-2-4-5-3-1;;;;/h1-5H;3*1H;/q;;;;+3/p-3 |
| InChIKey | AENCLWKVWIIOQH-UHFFFAOYSA-K |
| SMILES | Cl[Ti](Cl)Cl.[CH]1[CH][CH][CH][CH]1 |
| CAS DataBase Reference | 1270-98-0(CAS DataBase Reference) |
Description and Uses
Precursor for cyclopentadienyltitanium(IV) complexes, and used as catalysts for alkene polymerizations.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-28-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | XR1927300 |
| F | 10-21 |
| TSCA | No |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29310099 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Toxicity | mouse,LD50,parenteral,130mg/kg (130mg/kg),European Journal of Medicinal Chemistry--Chimie Therapeutique. Vol. 19, Pg. 347, 1984. |





