A2662412
4-<WBR>Carboxy-<WBR>2-<WBR>fluorophenylboronic acid pinacol ester , 97% , 1050423-87-4
Synonym(s):
3-Fluoro-4-(4,4,5,5-tetramethyl)-1,3,2-dioxaborolan-2-yl)benzoic acid
CAS NO.：1050423-87-4
Empirical Formula: C13H16BFO4
Molecular Weight: 266.07
MDL number: MFCD12756466
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB80.80 | In Stock |
|
| 1G | RMB204.00 | In Stock |
|
| 5g | RMB967.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 199-204℃ |
| Boiling point: | 379.3±32.0 °C(Predicted) |
| Density | 1.20±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 3.75±0.10(Predicted) |
| form | Solid |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C13H16BFO4/c1-12(2)13(3,4)19-14(18-12)9-6-5-8(11(16)17)7-10(9)15/h5-7H,1-4H3,(H,16,17) |
| InChIKey | JSQNZNXVVRPGTD-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(B2OC(C)(C)C(C)(C)O2)C(F)=C1 |
| CAS DataBase Reference | 1050423-87-4 |
Description and Uses
4-Carboxy-2-fluorophenylboronic acid, pinacol ester
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2931900090 |
