A2666712
Clemizole hydrochloride , 98%(HPLC) , 1163-36-6
Synonym(s):
1-(p-Chlorobenzyl)-2-(1-pyrrolidinylmethyl)benzimidazole hydrochloride;1-(p-Chlorobenzyl)-2-pyrrolidylmethylenebenzimidazole hydrochloride;1-[(4-Chlorophenyl)methyl]-2-(1-pyrrolidinylmethyl)-1H-benzimidazole hydrochloride;CID 2782 hydrochloride;NSC 46261 hydrochloride
CAS NO.:1163-36-6
Empirical Formula: C19H21Cl2N3
Molecular Weight: 362.3
MDL number: MFCD00051435
EINECS: 214-605-4
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB305.60 | In Stock |
|
| 10MG | RMB473.60 | In Stock |
|
| 25MG | RMB817.60 | In Stock |
|
| 50mg | RMB1800.80 | In Stock |
|
| 100mg | RMB2871.20 | In Stock |
|
| 250mg | RMB6399.20 | In Stock |
|
| 500mg | RMB9599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 239-241° |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | H2O: soluble2mg/mL, clear (warmed) |
| form | powder |
| color | white to beige |
| Water Solubility | 16.84mg/L at 25℃ |
| Merck | 14,2346 |
| InChI | InChI=1S/C19H20ClN3.ClH/c20-16-9-7-15(8-10-16)13-23-18-6-2-1-5-17(18)21-19(23)14-22-11-3-4-12-22;/h1-2,5-10H,3-4,11-14H2;1H |
| InChIKey | DNFMJYXRIMLMBZ-UHFFFAOYSA-N |
| SMILES | N1(CC2C=CC(Cl)=CC=2)C(CN2CCCC2)=NC2C=CC=CC1=2.Cl |
| LogP | 1.99 |
| CAS DataBase Reference | 1163-36-6(CAS DataBase Reference) |
Description and Uses
Clemizole Hydrochloride inhibits Hepatitis C RNA replication in cell culture through the suppression of the binding between the nonstructural protein 4B and the viral RNA genome with little toxicity for the host cell. Clemizole Hydrochloride is also a potent inhibitor of transient receptor potential channel TRPC5.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| RTECS | DD6730000 |
| HS Code | 2933.99.8290 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |



![(1-Methyl-1H-benzo[d]imidazol-2-yl)methanamine](https://img.chemicalbook.com/CAS/GIF/20028-40-4.gif)

![(1H-Benzo[d]imidazol-2-yl)methanamine](https://img.chemicalbook.com/CAS/GIF/5805-57-2.gif)

