A2674612
CP-101,606 , 98%(HPLC) , 134234-12-1
Synonym(s):
CP-101,606 - CAS 134234-12-1 - Calbiochem;Traxoprodil, CP-101606, (1S,2S)-1-(4-hydroxy-phenyl)-2-(4-hydroxy-4-phenylpiperidino)-1-propanol, NMDA Antagonist VI;Traxoprodil; (1S,2S)-1-(4-hydroxy-phenyl)-2-(4-hydroxy-4-phenylpiperidino)-1-propanol; CP-101606
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB452.80 | In Stock |
|
| 10mg | RMB700.00 | In Stock |
|
| 25MG | RMB1727.20 | In Stock |
|
| 50mg | RMB2847.20 | In Stock |
|
| 100mg | RMB4975.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 534.4±50.0 °C(Predicted) |
| Density | 1.228 |
| storage temp. | 2-8°C |
| solubility | DMSO: ≥35mg/mL |
| pka | 9.99±0.26(Predicted) |
| form | powder |
| color | white to tan |
| optical activity | [α]/D +50 to +60° (c=1, MeOH) |
| InChI | 1S/C20H25NO3/c1-15(19(23)16-7-9-18(22)10-8-16)21-13-11-20(24,12-14-21)17-5-3-2-4-6-17/h2-10,15,19,22-24H,11-14H2,1H3/t15-,19+/m0/s1 |
| InChIKey | QEMSVZNTSXPFJA-HNAYVOBHSA-N |
| SMILES | C[C@@H]([C@@H](O)c1ccc(O)cc1)N2CCC(O)(CC2)c3ccccc3 |
Description and Uses
Traxoprodil (CP101,606) is a potent and selective NMDA antagonist and protect hippocampal neurons with an IC50 of 10 nM.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H319-H400 |
| Precautionary statements | P273-P301+P310-P305+P351+P338 |
| Hazard Codes | T,N |
| Risk Statements | 25-36-50 |
| Safety Statements | 26-45-61 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| Storage Class | 11 - Combustible Solids |




