A2701312
5-<WBR>Chloro-<WBR>2-<WBR>(trichloromethyl)<WBR>benzimidazole , 95% , 3584-66-5
CAS NO.：3584-66-5
Empirical Formula: C8H4Cl4N2
Molecular Weight: 269.94
MDL number: MFCD00005595
EINECS: 222-713-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB261.60 | In Stock |
|
| 1G | RMB637.60 | In Stock |
|
| 5G | RMB1803.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 223-224 °C (dec.)(lit.) |
| Boiling point: | 419.39°C (rough estimate) |
| Density | 1.7547 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Powder |
| color | Light beige to light brown |
| InChI | 1S/C8H4Cl4N2/c9-4-1-2-5-6(3-4)14-7(13-5)8(10,11)12/h1-3H,(H,13,14) |
| InChIKey | SIZGSKQSWJIWFP-UHFFFAOYSA-N |
| SMILES | Clc1ccc2[nH]c(nc2c1)C(Cl)(Cl)Cl |
| CAS DataBase Reference | 3584-66-5 |
Description and Uses
The effect of 5-chloro-2-trichloromethyl benzimidazole on binding affinity of human growth hormone (hGH) (Thr175 → Gly–hGH) to the extracellular domain of the hGH receptor (Trp104 → Gly–hGHbp) has been investigated.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P310-P305+P351+P338-P311 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 22-26-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29339980 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
