A2790226
4-(Benzyloxy)aniline hydrochloride , ≥98% , 51388-20-6
Synonym(s):
4-Aminophenyl benzyl ether hydrochloride
CAS NO.:51388-20-6
Empirical Formula: C13H14ClNO
Molecular Weight: 235.71
MDL number: MFCD00012995
EINECS: 257-170-6
| Pack Size | Price | Stock | Quantity |
| 25G | RMB65.60 | In Stock |
|
| 100G | RMB221.60 | In Stock |
|
| 250g | RMB415.20 | In Stock |
|
| 500g | RMB830.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 228 °C (dec.)(lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Slightly soluble in water insoluble in ether sparingly soluble in methanol |
| form | Crystalline Powder |
| color | Brownish |
| BRN | 3633307 |
| InChI | InChI=1S/C13H13NO.ClH/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11;/h1-9H,10,14H2;1H |
| InChIKey | KQBDLOVXZHOAJI-UHFFFAOYSA-N |
| SMILES | C1(=CC=C(N)C=C1)OCC1=CC=CC=C1.Cl |
| CAS DataBase Reference | 51388-20-6(CAS DataBase Reference) |
Description and Uses
4-(benzyloxy)aniline hydrochloride can be used in chemical synthesis studies.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-36/37 |
| WGK Germany | 3 |
| RTECS | BW7615000 |
| Hazard Note | Irritant |
| HS Code | 29222900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Sens. 1 |






