A2793026
2-Methyl-4-nitroanisole , 97% , 50741-92-9
CAS NO.：50741-92-9
Empirical Formula: C8H9NO3
Molecular Weight: 167.16
MDL number: MFCD07787583
EINECS: 256-748-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 10g | RMB95.20 | In Stock |
|
| 5g | RMB109.60 | In Stock |
|
| 25g | RMB392.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 61-64 °C(lit.) |
| Boiling point: | 283.0±20.0 °C(Predicted) |
| Density | 1.180±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Solid |
| color | Off-White |
| InChI | 1S/C8H9NO3/c1-6-5-7(9(10)11)3-4-8(6)12-2/h3-5H,1-2H3 |
| InChIKey | QOZMIJZYJZQOBV-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1C)[N+]([O-])=O |
Description and Uses
2-Methyl-4-nitroanisole may be used in the synthesis of 2-methyl-4-nitrophenol and 3-methyl-4-methoxyaniline.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2909309090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
