Perfluorodecalin , 95%(mixtureofcisandtrans) , 306-94-5
Synonym(s):
Octadecafluorodecahydronaphthalene (cis+trans);Perflunafene;Perfluorodecahydronaphthalene;Perfluorodecahydronaphthalene (cis+trans);Perfluorodecalin
CAS NO.:306-94-5
Empirical Formula: C10F18
Molecular Weight: 462.08
MDL number: MFCD00010626
EINECS: 206-192-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB50.40 | In Stock |
|
| 5G | RMB127.20 | In Stock |
|
| 25G | RMB343.20 | In Stock |
|
| 100g | RMB1103.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | -10 °C (lit.) |
| Boiling point: | 142 °C (lit.) |
| Density | 1.908 g/mL at 25 °C (lit.) |
| vapor density | 17.5 (vs air) |
| vapor pressure | 8.8hPa at 25℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Store below +30°C. |
| form | Liquid |
| Specific Gravity | 1.908 |
| color | Clear colorless |
| Water Solubility | Insoluble |
| Merck | 14,4183 |
| BRN | 2067113 |
| Cosmetics Ingredients Functions | SOLVENT SKIN CONDITIONING DETANGLING |
| InChI | 1S/C10F18/c11-1-2(12,5(17,18)9(25,26)7(21,22)3(1,13)14)6(19,20)10(27,28)8(23,24)4(1,15)16 |
| InChIKey | UWEYRJFJVCLAGH-UHFFFAOYSA-N |
| SMILES | FC1(F)C(F)(F)C(F)(F)C2(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)C1(F)F |
| LogP | 5.02-666 at 25℃ |
| Surface tension | 10mN/m at 293.15K |
| CAS DataBase Reference | 306-94-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Perflunafene(306-94-5) |
| EPA Substance Registry System | Perfluorodecalin (306-94-5) |
Description and Uses
Perfluorodecalin (PFD) is a chemically and biologicallyinert biomaterial and, as many perfluorocarbons, is alsohydrophobic, radiopaque and has a high solute capacity forgases such as oxygen.
Perfluorodecalin is a fluorocarbon and derivative of decalin, and used in cosmetics and beauty products as to dissolve and deliver oxygen to the skin in formulas (Wikipedia). It is also used as a skin conditioning agent, detangler, and solvent in some formulas. Perfluorodecalin's ability to dissolve oxygen is thought to revitalize skin and reduce wrinkles, increasing the partial pressure of oxygen (pO2), according to research.
Some studies have shown that formulas that include Perflurodecalin improve the skin's barrier function resulting in increased moisturizing efficacy. However, there are no studies to prove that added oxygen can actually repair wrinkled skin or prevent lines from forming. Conversely, too much oxygen can enhance the number of unstable oxygen molecules which cause free radical damage.
Perfluorodecalin is used as a building block reagent as well maintains ability to dissolve gases such as oxygen and increase oxygen to a location allowing for medicinal uses such as preserving tissue after pancreas transplants.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F |
| Risk Statements | 10 |
| Safety Statements | 23-24/25-41-16 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| RTECS | QJ3175000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29038900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
| Toxicity | LD50 ivn-mus: 50 mg/kg PGPKA8 27(10),8,82 |




