A2832812
2-Chloro-5-fluoro-3-nitropyridine , 98% , 136888-21-6
CAS NO.：136888-21-6
Empirical Formula: C5H2ClFN2O2
Molecular Weight: 176.53
MDL number: MFCD06659490
| Pack Size | Price | Stock | Quantity |
| 1G | RMB76.00 | In Stock |
|
| 5G | RMB287.20 | In Stock |
|
| 25G | RMB1241.60 | In Stock |
|
| 100g | RMB4104.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 48.0 to 52.0 °C |
| Boiling point: | 246℃ |
| Density | 1.595 |
| Flash point: | 103℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | -4.94±0.10(Predicted) |
| color | White to Yellow to Green |
| InChI | InChI=1S/C5H2ClFN2O2/c6-5-4(9(10)11)1-3(7)2-8-5/h1-2H |
| InChIKey | SVVZGNAZMPSGMU-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(F)C=C1[N+]([O-])=O |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| HS Code | 2933399990 |
