A2852212
3-Chloro-2-hydrazinylpyridine , 98% , 22841-92-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB144.80 | In Stock |
|
| 100G | RMB473.60 | In Stock |
|
| 500g | RMB1755.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-167° |
| Boiling point: | 247.6±50.0 °C(Predicted) |
| Density | 1.43±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| pka | 8.65±0.70(Predicted) |
| form | solid |
| color | White |
| InChI | InChI=1S/C5H6ClN3/c6-4-2-1-3-8-5(4)9-7/h1-3H,7H2,(H,8,9) |
| InChIKey | XAYCTBDPZIKHCW-UHFFFAOYSA-N |
| SMILES | C1(NN)=NC=CC=C1Cl |
Description and Uses
3-chloro-2-hydrazino pyridine is the important intermediate of synthesizing new ryania acceptor sterilant Rynaxypyr (Chlorantraniliprole) and cyanogen insect amide (Cyantraniliprole).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
![2-[3-CHLORO-5-(TRIFLUOROMETHYL)-2-PYRIDINYL]-1-HYDRAZINECARBOXAMIDE](https://img.chemicalbook.com/StructureFile/ChemBookStructure2/GIF/CB9241570.gif)
